C25H26F2N2O13S — CID 161298089
(3S,4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol;[(2R,3R,4S)-4-fluoro-5-methoxy-3-(4-nitrobenzoyl)oxyoxolan-2-yl]methyl 4-nitrobenzoate (PubChem CID 161298089) has the molecular formula C25H26F2N2O13S and a molecular weight of 632.55 g/mol. Its IUPAC name is (3S,4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol;[(2R,3R,4S)-4-fluoro-5-methoxy-3-(4-nitrobenzoyl)oxyoxolan-2-yl]methyl 4-nitrobenzoate.
| Compound Name | (3S,4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol;[(2R,3R,4S)-4-fluoro-5-methoxy-3-(4-nitrobenzoyl)oxyoxolan-2-yl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 161298089 |
| Molecular Formula | C25H26F2N2O13S |
| Molecular Weight | 632.55 g/mol |
| Exact Mass | 632.11 |
| IUPAC Name | (3S,4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol;[(2R,3R,4S)-4-fluoro-5-methoxy-3-(4-nitrobenzoyl)oxyoxolan-2-yl]methyl 4-nitrobenzoate |
| SMILES | COC1O[C@H](COC(=O)c2ccc([N+](=O)[O-])cc2)[C@@H](OC(=O)c2ccc([N+](=O)[O-])cc2)[C@@H]1F.OC[C@H]1SC(O)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C20H17FN2O10.C5H9FO3S/c1-30-20-16(21)17(33-19(25)12-4-8-14(9-5-12)23(28)29)15(32-20)10-31-18(24)11-2-6-13(7-3-11)22(26)27;6-3-4(8)2(1-7)10-5(3)9/h2-9,15-17,20H,10H2,1H3;2-5,7-9H,1H2/t15-,16+,17-,20?;2-,3+,4-,5?/m11/s1 |
| InChIKey | VHFYTGZMZYKVQH-FMOUTPIJSA-N |
| XLogP | 1.71 |
| TPSA | 218.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.55 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|