C13H15FN2O6 — CID 142537483
[2-(aminomethyl)-4-fluoro-6-hydroxyoxan-3-yl] 4-nitrobenzoate (PubChem CID 142537483) has the molecular formula C13H15FN2O6 and a molecular weight of 314.27 g/mol. Its IUPAC name is [2-(aminomethyl)-4-fluoro-6-hydroxyoxan-3-yl] 4-nitrobenzoate.
| Compound Name | [2-(aminomethyl)-4-fluoro-6-hydroxyoxan-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 142537483 |
| Molecular Formula | C13H15FN2O6 |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | [2-(aminomethyl)-4-fluoro-6-hydroxyoxan-3-yl] 4-nitrobenzoate |
| SMILES | NCC1OC(O)CC(F)C1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H15FN2O6/c14-9-5-11(17)21-10(6-15)12(9)22-13(18)7-1-3-8(4-2-7)16(19)20/h1-4,9-12,17H,5-6,15H2 |
| InChIKey | ORZKIWGPXHWPMP-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|