C23H34N6O10 — CID 167267452
[(2R,3R,4R,5R,6R)-4,5-diamino-2-(aminomethyl)-6-[(1R,2S,3S,4R,6S)-2,3-diacetyloxy-4,6-diaminocyclohexyl]oxyoxan-3-yl] 4-nitrobenzoate (PubChem CID 167267452) has the molecular formula C23H34N6O10 and a molecular weight of 554.56 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-4,5-diamino-2-(aminomethyl)-6-[(1R,2S,3S,4R,6S)-2,3-diacetyloxy-4,6-diaminocyclohexyl]oxyoxan-3-yl] 4-nitrobenzoate.
| Compound Name | [(2R,3R,4R,5R,6R)-4,5-diamino-2-(aminomethyl)-6-[(1R,2S,3S,4R,6S)-2,3-diacetyloxy-4,6-diaminocyclohexyl]oxyoxan-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 167267452 |
| Molecular Formula | C23H34N6O10 |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-4,5-diamino-2-(aminomethyl)-6-[(1R,2S,3S,4R,6S)-2,3-diacetyloxy-4,6-diaminocyclohexyl]oxyoxan-3-yl] 4-nitrobenzoate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)[C@H](N)[C@H]1N |
| InChI | InChI=1S/C23H34N6O10/c1-9(30)35-18-13(25)7-14(26)19(21(18)36-10(2)31)39-23-17(28)16(27)20(15(8-24)37-23)38-22(32)11-3-5-12(6-4-11)29(33)34/h3-6,13-21,23H,7-8,24-28H2,1-2H3/t13-,14+,15-,16-,17-,18+,19-,20+,21-,23-/m1/s1 |
| InChIKey | XEMYOZZTXYJWEJ-YJQGYLKJSA-N |
| XLogP | -2.23 |
| TPSA | 270.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|