C33H27NO10S — CID 131885113
[(2R,3S,4S,5R,6R)-4,5-dibenzoyloxy-3-hydroxy-6-(4-nitrophenyl)sulfanyloxan-2-yl]methyl benzoate (PubChem CID 131885113) has the molecular formula C33H27NO10S and a molecular weight of 629.64 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-4,5-dibenzoyloxy-3-hydroxy-6-(4-nitrophenyl)sulfanyloxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R,6R)-4,5-dibenzoyloxy-3-hydroxy-6-(4-nitrophenyl)sulfanyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 131885113 |
| Molecular Formula | C33H27NO10S |
| Molecular Weight | 629.64 g/mol |
| Exact Mass | 629.14 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-4,5-dibenzoyloxy-3-hydroxy-6-(4-nitrophenyl)sulfanyloxan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@H](Sc2ccc([N+](=O)[O-])cc2)[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C33H27NO10S/c35-27-26(20-41-30(36)21-10-4-1-5-11-21)42-33(45-25-18-16-24(17-19-25)34(39)40)29(44-32(38)23-14-8-3-9-15-23)28(27)43-31(37)22-12-6-2-7-13-22/h1-19,26-29,33,35H,20H2/t26-,27+,28+,29-,33-/m1/s1 |
| InChIKey | PWFFEXKMPSDBKP-SMWBDTCFSA-N |
| XLogP | 5.08 |
| TPSA | 151.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|