C46H42O14S — CID 71490751
[(2R,3R,4S,5S,6S)-3,4,5-tribenzoyloxy-6-[[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-phenylsulfanyloxan-2-yl]methoxy]oxan-2-yl]methyl benzoate (PubChem CID 71490751) has the molecular formula C46H42O14S and a molecular weight of 850.90 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3,4,5-tribenzoyloxy-6-[[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-phenylsulfanyloxan-2-yl]methoxy]oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5S,6S)-3,4,5-tribenzoyloxy-6-[[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-phenylsulfanyloxan-2-yl]methoxy]oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 71490751 |
| Molecular Formula | C46H42O14S |
| Molecular Weight | 850.90 g/mol |
| Exact Mass | 850.23 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3,4,5-tribenzoyloxy-6-[[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-phenylsulfanyloxan-2-yl]methoxy]oxan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@H](OC[C@H]2O[C@H](Sc3ccccc3)[C@@H](O)[C@@H](O)[C@@H]2O)[C@@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H42O14S/c47-35-33(57-46(37(49)36(35)48)61-32-24-14-5-15-25-32)26-55-45-40(60-44(53)31-22-12-4-13-23-31)39(59-43(52)30-20-10-3-11-21-30)38(58-42(51)29-18-8-2-9-19-29)34(56-45)27-54-41(50)28-16-6-1-7-17-28/h1-25,33-40,45-49H,26-27H2/t33-,34-,35-,36+,37+,38-,39+,40+,45+,46-/m1/s1 |
| InChIKey | VWJSXKMZXQZMCA-FSMYMYBBSA-N |
| XLogP | 4.86 |
| TPSA | 193.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.90 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|