C29H27Cl3O10S2 — CID 44605555
[(2R,3R,4S,5R,6S)-5-benzoyloxy-3-hydroxy-6-(4-methylphenyl)sulfanyl-4-(2,2,2-trichloroethoxysulfonyloxy)oxan-2-yl]methyl benzoate (PubChem CID 44605555) has the molecular formula C29H27Cl3O10S2 and a molecular weight of 706.02 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-5-benzoyloxy-3-hydroxy-6-(4-methylphenyl)sulfanyl-4-(2,2,2-trichloroethoxysulfonyloxy)oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-5-benzoyloxy-3-hydroxy-6-(4-methylphenyl)sulfanyl-4-(2,2,2-trichloroethoxysulfonyloxy)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 44605555 |
| Molecular Formula | C29H27Cl3O10S2 |
| Molecular Weight | 706.02 g/mol |
| Exact Mass | 704.01 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-5-benzoyloxy-3-hydroxy-6-(4-methylphenyl)sulfanyl-4-(2,2,2-trichloroethoxysulfonyloxy)oxan-2-yl]methyl benzoate |
| SMILES | Cc1ccc(S[C@@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](O)[C@H](OS(=O)(=O)OCC(Cl)(Cl)Cl)[C@H]2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H27Cl3O10S2/c1-18-12-14-21(15-13-18)43-28-25(41-27(35)20-10-6-3-7-11-20)24(42-44(36,37)39-17-29(30,31)32)23(33)22(40-28)16-38-26(34)19-8-4-2-5-9-19/h2-15,22-25,28,33H,16-17H2,1H3/t22-,23-,24+,25-,28+/m1/s1 |
| InChIKey | YVYYUXHPQSIEAD-MOBZEUQDSA-N |
| XLogP | 5.27 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.02 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|