C25H25Cl3O11S — CID 44605553
[(2R,3R,4S,5R,6S)-5-benzoyloxy-3-hydroxy-6-prop-2-enoxy-4-(2,2,2-trichloroethoxysulfonyloxy)oxan-2-yl]methyl benzoate (PubChem CID 44605553) has the molecular formula C25H25Cl3O11S and a molecular weight of 639.89 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-5-benzoyloxy-3-hydroxy-6-prop-2-enoxy-4-(2,2,2-trichloroethoxysulfonyloxy)oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-5-benzoyloxy-3-hydroxy-6-prop-2-enoxy-4-(2,2,2-trichloroethoxysulfonyloxy)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 44605553 |
| Molecular Formula | C25H25Cl3O11S |
| Molecular Weight | 639.89 g/mol |
| Exact Mass | 638.02 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-5-benzoyloxy-3-hydroxy-6-prop-2-enoxy-4-(2,2,2-trichloroethoxysulfonyloxy)oxan-2-yl]methyl benzoate |
| SMILES | C=CCO[C@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](O)[C@H](OS(=O)(=O)OCC(Cl)(Cl)Cl)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H25Cl3O11S/c1-2-13-34-24-21(38-23(31)17-11-7-4-8-12-17)20(39-40(32,33)36-15-25(26,27)28)19(29)18(37-24)14-35-22(30)16-9-5-3-6-10-16/h2-12,18-21,24,29H,1,13-15H2/t18-,19-,20+,21-,24+/m1/s1 |
| InChIKey | YUNOURSGQSJROU-IDYLKPADSA-N |
| XLogP | 3.37 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.89 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|