C34H29ClN2O11S — CID 101108307
[(2S,3S,4R,5S,6R)-5-[(2-chlorophenyl)methoxy]-4-hydroxy-6-(4-methylphenyl)sulfanyl-3-(4-nitrobenzoyl)oxyoxan-2-yl]methyl 4-nitrobenzoate (PubChem CID 101108307) has the molecular formula C34H29ClN2O11S and a molecular weight of 709.13 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6R)-5-[(2-chlorophenyl)methoxy]-4-hydroxy-6-(4-methylphenyl)sulfanyl-3-(4-nitrobenzoyl)oxyoxan-2-yl]methyl 4-nitrobenzoate.
| Compound Name | [(2S,3S,4R,5S,6R)-5-[(2-chlorophenyl)methoxy]-4-hydroxy-6-(4-methylphenyl)sulfanyl-3-(4-nitrobenzoyl)oxyoxan-2-yl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 101108307 |
| Molecular Formula | C34H29ClN2O11S |
| Molecular Weight | 709.13 g/mol |
| Exact Mass | 708.12 |
| IUPAC Name | [(2S,3S,4R,5S,6R)-5-[(2-chlorophenyl)methoxy]-4-hydroxy-6-(4-methylphenyl)sulfanyl-3-(4-nitrobenzoyl)oxyoxan-2-yl]methyl 4-nitrobenzoate |
| SMILES | Cc1ccc(S[C@H]2O[C@@H](COC(=O)c3ccc([N+](=O)[O-])cc3)[C@@H](OC(=O)c3ccc([N+](=O)[O-])cc3)[C@@H](O)[C@@H]2OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C34H29ClN2O11S/c1-20-6-16-26(17-7-20)49-34-31(45-18-23-4-2-3-5-27(23)35)29(38)30(48-33(40)22-10-14-25(15-11-22)37(43)44)28(47-34)19-46-32(39)21-8-12-24(13-9-21)36(41)42/h2-17,28-31,34,38H,18-19H2,1H3/t28-,29+,30+,31-,34+/m0/s1 |
| InChIKey | RVTNBKWKHHTRJR-XZGCIERJSA-N |
| XLogP | 6.31 |
| TPSA | 177.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.13 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|