C26H24N2O11S — CID 11734506
[(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-(4-nitrophenyl)sulfanyloxan-2-yl]methyl acetate (PubChem CID 11734506) has the molecular formula C26H24N2O11S and a molecular weight of 572.55 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-(4-nitrophenyl)sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-(4-nitrophenyl)sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11734506 |
| Molecular Formula | C26H24N2O11S |
| Molecular Weight | 572.55 g/mol |
| Exact Mass | 572.11 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(1,3-dioxoisoindol-2-yl)-6-(4-nitrophenyl)sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Sc2ccc([N+](=O)[O-])cc2)[C@H](N2C(=O)c3ccccc3C2=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H24N2O11S/c1-13(29)36-12-20-22(37-14(2)30)23(38-15(3)31)21(27-24(32)18-6-4-5-7-19(18)25(27)33)26(39-20)40-17-10-8-16(9-11-17)28(34)35/h4-11,20-23,26H,12H2,1-3H3/t20-,21-,22-,23-,26+/m1/s1 |
| InChIKey | WOYMIVURHONWSV-HDXRJONQSA-N |
| XLogP | 2.50 |
| TPSA | 168.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.55 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|