C14H18N4O10 — CID 177212395
1-[(3R,4R,5R,6R)-3-[2-(2,4-dinitrophenyl)hydrazinyl]-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone (PubChem CID 177212395) has the molecular formula C14H18N4O10 and a molecular weight of 402.32 g/mol. Its IUPAC name is 1-[(3R,4R,5R,6R)-3-[2-(2,4-dinitrophenyl)hydrazinyl]-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone.
| Compound Name | 1-[(3R,4R,5R,6R)-3-[2-(2,4-dinitrophenyl)hydrazinyl]-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone |
|---|---|
| PubChem CID | 177212395 |
| Molecular Formula | C14H18N4O10 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 1-[(3R,4R,5R,6R)-3-[2-(2,4-dinitrophenyl)hydrazinyl]-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethanone |
| SMILES | CC(=O)C1(O)O[C@H](CO)[C@H](O)[C@H](O)[C@H]1NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N4O10/c1-6(20)14(23)13(12(22)11(21)10(5-19)28-14)16-15-8-3-2-7(17(24)25)4-9(8)18(26)27/h2-4,10-13,15-16,19,21-23H,5H2,1H3/t10-,11+,12+,13-,14?/m1/s1 |
| InChIKey | QPYSZYAZGOHJBG-RRYROLNDSA-N |
| XLogP | -1.82 |
| TPSA | 217.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|