C15H19NO10 — CID 140985689
methyl 2-[(2S,3R,4S,5S,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)-2-(4-nitrophenyl)oxan-4-yl]oxyacetate (PubChem CID 140985689) has the molecular formula C15H19NO10 and a molecular weight of 373.31 g/mol. Its IUPAC name is methyl 2-[(2S,3R,4S,5S,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)-2-(4-nitrophenyl)oxan-4-yl]oxyacetate.
| Compound Name | methyl 2-[(2S,3R,4S,5S,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)-2-(4-nitrophenyl)oxan-4-yl]oxyacetate |
|---|---|
| PubChem CID | 140985689 |
| Molecular Formula | C15H19NO10 |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | methyl 2-[(2S,3R,4S,5S,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)-2-(4-nitrophenyl)oxan-4-yl]oxyacetate |
| SMILES | COC(=O)CO[C@H]1[C@@H](O)[C@@H](CO)O[C@@](O)(c2ccc([N+](=O)[O-])cc2)[C@@H]1O |
| InChI | InChI=1S/C15H19NO10/c1-24-11(18)7-25-13-12(19)10(6-17)26-15(21,14(13)20)8-2-4-9(5-3-8)16(22)23/h2-5,10,12-14,17,19-21H,6-7H2,1H3/t10-,12+,13+,14-,15+/m1/s1 |
| InChIKey | CVJOPQUHRBNTGX-NZNQWUEYSA-N |
| XLogP | -1.59 |
| TPSA | 168.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|