C18H19NO12 — CID 141203968
(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-hydroxy-6-(4-nitrophenyl)oxane-2-carboxylic acid (PubChem CID 141203968) has the molecular formula C18H19NO12 and a molecular weight of 441.35 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-hydroxy-6-(4-nitrophenyl)oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-hydroxy-6-(4-nitrophenyl)oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 141203968 |
| Molecular Formula | C18H19NO12 |
| Molecular Weight | 441.35 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-hydroxy-6-(4-nitrophenyl)oxane-2-carboxylic acid |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@](O)(c2ccc([N+](=O)[O-])cc2)O[C@@H]1C(=O)O |
| InChI | InChI=1S/C18H19NO12/c1-8(20)28-13-14(29-9(2)21)16(30-10(3)22)18(25,31-15(13)17(23)24)11-4-6-12(7-5-11)19(26)27/h4-7,13-16,25H,1-3H3,(H,23,24)/t13-,14-,15-,16+,18+/m0/s1 |
| InChIKey | VNUGFPPXOPHBFU-YXISZKLHSA-N |
| XLogP | 0.02 |
| TPSA | 188.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|