C16H17NO7S2 — CID 101080752
[(1S,4S,5R,7S,8R)-8-acetyloxy-7-(4-nitrophenyl)sulfanyl-6-oxa-2-thiabicyclo[3.2.1]octan-4-yl] acetate (PubChem CID 101080752) has the molecular formula C16H17NO7S2 and a molecular weight of 399.45 g/mol. Its IUPAC name is [(1S,4S,5R,7S,8R)-8-acetyloxy-7-(4-nitrophenyl)sulfanyl-6-oxa-2-thiabicyclo[3.2.1]octan-4-yl] acetate.
| Compound Name | [(1S,4S,5R,7S,8R)-8-acetyloxy-7-(4-nitrophenyl)sulfanyl-6-oxa-2-thiabicyclo[3.2.1]octan-4-yl] acetate |
|---|---|
| PubChem CID | 101080752 |
| Molecular Formula | C16H17NO7S2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | [(1S,4S,5R,7S,8R)-8-acetyloxy-7-(4-nitrophenyl)sulfanyl-6-oxa-2-thiabicyclo[3.2.1]octan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2O[C@@H](Sc3ccc([N+](=O)[O-])cc3)[C@H]1SC[C@H]2OC(C)=O |
| InChI | InChI=1S/C16H17NO7S2/c1-8(18)22-12-7-25-15-14(23-9(2)19)13(12)24-16(15)26-11-5-3-10(4-6-11)17(20)21/h3-6,12-16H,7H2,1-2H3/t12-,13-,14-,15+,16+/m1/s1 |
| InChIKey | GKQODIGGAZGZLN-SUJAAXHWSA-N |
| XLogP | 2.39 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|