C25H24O11 — CID 142216375
(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-benzoylphenyl)-6-hydroxyoxane-2-carboxylic acid (PubChem CID 142216375) has the molecular formula C25H24O11 and a molecular weight of 500.46 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-benzoylphenyl)-6-hydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-benzoylphenyl)-6-hydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 142216375 |
| Molecular Formula | C25H24O11 |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-benzoylphenyl)-6-hydroxyoxane-2-carboxylic acid |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@](O)(c2cccc(C(=O)c3ccccc3)c2)O[C@@H]1C(=O)O |
| InChI | InChI=1S/C25H24O11/c1-13(26)33-20-21(34-14(2)27)23(35-15(3)28)25(32,36-22(20)24(30)31)18-11-7-10-17(12-18)19(29)16-8-5-4-6-9-16/h4-12,20-23,32H,1-3H3,(H,30,31)/t20-,21-,22-,23+,25+/m0/s1 |
| InChIKey | HENCASKQRGDLEK-FPDJOHNTSA-N |
| XLogP | 1.34 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|