C28H36O11 — CID 69197767
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-hydroxy-6-[2-[(4-methoxycyclohexylidene)methyl]phenyl]oxan-2-yl]methyl acetate (PubChem CID 69197767) has the molecular formula C28H36O11 and a molecular weight of 548.59 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-hydroxy-6-[2-[(4-methoxycyclohexylidene)methyl]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-hydroxy-6-[2-[(4-methoxycyclohexylidene)methyl]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 69197767 |
| Molecular Formula | C28H36O11 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-hydroxy-6-[2-[(4-methoxycyclohexylidene)methyl]phenyl]oxan-2-yl]methyl acetate |
| SMILES | COC1CCC(=Cc2ccccc2[C@]2(O)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)CC1 |
| InChI | InChI=1S/C28H36O11/c1-16(29)35-15-24-25(36-17(2)30)26(37-18(3)31)27(38-19(4)32)28(33,39-24)23-9-7-6-8-21(23)14-20-10-12-22(34-5)13-11-20/h6-9,14,22,24-27,33H,10-13,15H2,1-5H3/b20-14-/t22?,24-,25-,26+,27-,28+/m1/s1 |
| InChIKey | SUAAUFJDCMYHIO-NSYDJXIOSA-N |
| XLogP | 2.56 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|