C29H39O10+ — CID 143172091
1-[(2R,3R,4R,5S,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-[3-[(4-methoxycyclohexylidene)methyl]-4-methylphenyl]oxan-3-yl]oxyethylideneoxidanium (PubChem CID 143172091) has the molecular formula C29H39O10+ and a molecular weight of 547.62 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5S,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-[3-[(4-methoxycyclohexylidene)methyl]-4-methylphenyl]oxan-3-yl]oxyethylideneoxidanium.
| Compound Name | 1-[(2R,3R,4R,5S,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-[3-[(4-methoxycyclohexylidene)methyl]-4-methylphenyl]oxan-3-yl]oxyethylideneoxidanium |
|---|---|
| PubChem CID | 143172091 |
| Molecular Formula | C29H39O10+ |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | 1-[(2R,3R,4R,5S,6S)-4,5-diacetyloxy-2-(acetyloxymethyl)-6-[3-[(4-methoxycyclohexylidene)methyl]-4-methylphenyl]oxan-3-yl]oxyethylideneoxidanium |
| SMILES | [H]/[O+]=C(\C)O[C@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](c2ccc(C)c(C=C3CCC(OC)CC3)c2)O[C@@H]1COC(C)=O |
| InChI | InChI=1S/C29H38O10/c1-16-7-10-22(14-23(16)13-21-8-11-24(34-6)12-9-21)26-28(37-19(4)32)29(38-20(5)33)27(36-18(3)31)25(39-26)15-35-17(2)30/h7,10,13-14,24-29H,8-9,11-12,15H2,1-6H3/p+1/b21-13-/t24?,25-,26+,27-,28+,29+/m1/s1 |
| InChIKey | BAUGPGJKSPRNHB-YJMJAIODSA-O |
| XLogP | 3.74 |
| TPSA | 127.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|