C31H35ClO11 — CID 140524198
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-[(4-cyclobutyloxyphenyl)methyl]phenyl]-6-hydroxyoxan-2-yl]methyl acetate (PubChem CID 140524198) has the molecular formula C31H35ClO11 and a molecular weight of 619.06 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-[(4-cyclobutyloxyphenyl)methyl]phenyl]-6-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-[(4-cyclobutyloxyphenyl)methyl]phenyl]-6-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 140524198 |
| Molecular Formula | C31H35ClO11 |
| Molecular Weight | 619.06 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-[(4-cyclobutyloxyphenyl)methyl]phenyl]-6-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@](O)(c2ccc(Cl)c(Cc3ccc(OC4CCC4)cc3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C31H35ClO11/c1-17(33)38-16-27-28(39-18(2)34)29(40-19(3)35)30(41-20(4)36)31(37,43-27)23-10-13-26(32)22(15-23)14-21-8-11-25(12-9-21)42-24-6-5-7-24/h8-13,15,24,27-30,37H,5-7,14,16H2,1-4H3/t27-,28-,29+,30-,31-/m1/s1 |
| InChIKey | BVGUJPCYXINSPE-PXPWAULYSA-N |
| XLogP | 3.76 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.06 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|