C27H35ClO12 — CID 86602787
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-(4-methoxycyclohexyl)oxyphenyl]-6-hydroxyoxan-2-yl]methyl acetate (PubChem CID 86602787) has the molecular formula C27H35ClO12 and a molecular weight of 587.02 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-(4-methoxycyclohexyl)oxyphenyl]-6-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-(4-methoxycyclohexyl)oxyphenyl]-6-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 86602787 |
| Molecular Formula | C27H35ClO12 |
| Molecular Weight | 587.02 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-chloro-3-(4-methoxycyclohexyl)oxyphenyl]-6-hydroxyoxan-2-yl]methyl acetate |
| SMILES | COC1CCC(Oc2cc([C@@]3(O)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)ccc2Cl)CC1 |
| InChI | InChI=1S/C27H35ClO12/c1-14(29)35-13-23-24(36-15(2)30)25(37-16(3)31)26(38-17(4)32)27(33,40-23)18-6-11-21(28)22(12-18)39-20-9-7-19(34-5)8-10-20/h6,11-12,19-20,23-26,33H,7-10,13H2,1-5H3/t19?,20?,23-,24-,25+,26-,27-/m1/s1 |
| InChIKey | GHIQLFVRONNVQM-UAKLGFHKSA-N |
| XLogP | 2.58 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.02 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|