C26H33ClO12 — CID 69198120
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-(oxan-4-yloxy)phenyl]-6-methoxyoxan-2-yl]methyl acetate (PubChem CID 69198120) has the molecular formula C26H33ClO12 and a molecular weight of 572.99 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-(oxan-4-yloxy)phenyl]-6-methoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-(oxan-4-yloxy)phenyl]-6-methoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 69198120 |
| Molecular Formula | C26H33ClO12 |
| Molecular Weight | 572.99 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-(oxan-4-yloxy)phenyl]-6-methoxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@@]1(c2ccc(Cl)c(OC3CCOCC3)c2)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H33ClO12/c1-14(28)34-13-22-23(35-15(2)29)24(36-16(3)30)25(37-17(4)31)26(32-5,39-22)18-6-7-20(27)21(12-18)38-19-8-10-33-11-9-19/h6-7,12,19,22-25H,8-11,13H2,1-5H3/t22-,23-,24+,25-,26+/m1/s1 |
| InChIKey | YAIRBEIQMXEVRR-RTJMFUJLSA-N |
| XLogP | 2.45 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.99 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|