About CID 143282373
CID 143282373 (PubChem CID 143282373) has the molecular formula C39H52O10Si-
and a molecular weight of 708.92 g/mol.
Molecular Properties
| Compound Name | CID 143282373 |
| PubChem CID | 143282373 |
| Molecular Formula | C39H52O10Si- |
| Molecular Weight | 708.92 g/mol |
| Exact Mass | 708.33 |
| IUPAC Name | — |
| SMILES | COC1(c2cccc(Cc3ccc(C#C[Si-](C(C)C)(C(C)C)C(C)C)cc3)c2)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C39H52O10Si/c1-24(2)50(25(3)4,26(5)6)20-19-31-15-17-32(18-16-31)21-33-13-12-14-34(22-33)39(44-11)38(48-30(10)43)37(47-29(9)42)36(46-28(8)41)35(49-39)23-45-27(7)40/h12-18,22,24-26,35-38H,21,23H2,1-11H3/q-1/t35-,36-,37+,38-,39?/m1/s1 |
| InChIKey | DIRCTSBDUFONLS-WVTZLKINSA-N |
| XLogP | 6.40 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 708.92 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 143282373 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143282373?
The IUPAC name of CID 143282373 (CID 143282373) is not available.
What is the SMILES notation for CID 143282373?
The canonical SMILES for CID 143282373 is COC1(c2cccc(Cc3ccc(C#C[Si-](C(C)C)(C(C)C)C(C)C)cc3)c2)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O.
What is the InChIKey of CID 143282373?
The InChIKey is DIRCTSBDUFONLS-WVTZLKINSA-N. The full InChI is InChI=1S/C39H52O10Si/c1-24(2)50(25(3)4,26(5)6)20-19-31-15-17-32(18-16-31)21-33-13-12-14-34(22-33)39(44-11)38(48-30(10)43)37(47-29(9)42)36(46-28(8)41)35(49-39)23-45-27(7)40/h12-18,22,24-26,35-38H,21,23H2,1-11H3/q-1/t35-,36-,37+,38-,39?/m1/s1.
What are the key properties of CID 143282373?
CID 143282373 has a molecular weight of 708.92 g/mol, XLogP of 6.40, 12 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143282373 is sourced from PubChem (CID 143282373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).