C39H52O10Si- — CID 143282373
CID 143282373 (PubChem CID 143282373) has the molecular formula C39H52O10Si- and a molecular weight of 708.92 g/mol.
| Compound Name | CID 143282373 |
|---|---|
| PubChem CID | 143282373 |
| Molecular Formula | C39H52O10Si- |
| Molecular Weight | 708.92 g/mol |
| Exact Mass | 708.33 |
| IUPAC Name | — |
| SMILES | COC1(c2cccc(Cc3ccc(C#C[Si-](C(C)C)(C(C)C)C(C)C)cc3)c2)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C39H52O10Si/c1-24(2)50(25(3)4,26(5)6)20-19-31-15-17-32(18-16-31)21-33-13-12-14-34(22-33)39(44-11)38(48-30(10)43)37(47-29(9)42)36(46-28(8)41)35(49-39)23-45-27(7)40/h12-18,22,24-26,35-38H,21,23H2,1-11H3/q-1/t35-,36-,37+,38-,39?/m1/s1 |
| InChIKey | DIRCTSBDUFONLS-WVTZLKINSA-N |
| XLogP | 6.40 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.92 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|