C30H40O12 — CID 69199166
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-[(4,4-dimethoxycyclohexylidene)methyl]phenyl]-6-methoxyoxan-2-yl]methyl acetate (PubChem CID 69199166) has the molecular formula C30H40O12 and a molecular weight of 592.64 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-[(4,4-dimethoxycyclohexylidene)methyl]phenyl]-6-methoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-[(4,4-dimethoxycyclohexylidene)methyl]phenyl]-6-methoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 69199166 |
| Molecular Formula | C30H40O12 |
| Molecular Weight | 592.64 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-[(4,4-dimethoxycyclohexylidene)methyl]phenyl]-6-methoxyoxan-2-yl]methyl acetate |
| SMILES | COC1(OC)CCC(=Cc2cccc([C@]3(OC)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)c2)CC1 |
| InChI | InChI=1S/C30H40O12/c1-18(31)38-17-25-26(39-19(2)32)27(40-20(3)33)28(41-21(4)34)30(37-7,42-25)24-10-8-9-23(16-24)15-22-11-13-29(35-5,36-6)14-12-22/h8-10,15-16,25-28H,11-14,17H2,1-7H3/t25-,26-,27+,28-,30+/m1/s1 |
| InChIKey | RRQANJYXUMTIOP-IXMSMLDRSA-N |
| XLogP | 3.19 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.64 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|