C27H29BrO11 — CID 67131622
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[4-bromo-3-(phenoxymethyl)phenyl]-6-hydroxyoxan-2-yl]methyl acetate (PubChem CID 67131622) has the molecular formula C27H29BrO11 and a molecular weight of 609.42 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[4-bromo-3-(phenoxymethyl)phenyl]-6-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[4-bromo-3-(phenoxymethyl)phenyl]-6-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 67131622 |
| Molecular Formula | C27H29BrO11 |
| Molecular Weight | 609.42 g/mol |
| Exact Mass | 608.09 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[4-bromo-3-(phenoxymethyl)phenyl]-6-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(O)(c2ccc(Br)c(COc3ccccc3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H29BrO11/c1-15(29)34-14-23-24(36-16(2)30)25(37-17(3)31)26(38-18(4)32)27(33,39-23)20-10-11-22(28)19(12-20)13-35-21-8-6-5-7-9-21/h5-12,23-26,33H,13-14H2,1-4H3/t23-,24-,25+,26-,27?/m1/s1 |
| InChIKey | FHHFHTVVNNDWOH-MZIUKZFCSA-N |
| XLogP | 2.93 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|