C23H26BrNO10 — CID 141451778
[(2R,3R,4S,5R)-6-[3-(bromomethyl)-4-(cyanomethyl)phenyl]-3,4,5-tris[(2-deuterioacetyl)oxy]-6-hydroxyoxan-2-yl]methyl 2-deuterioacetate (PubChem CID 141451778) has the molecular formula C23H26BrNO10 and a molecular weight of 560.39 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-6-[3-(bromomethyl)-4-(cyanomethyl)phenyl]-3,4,5-tris[(2-deuterioacetyl)oxy]-6-hydroxyoxan-2-yl]methyl 2-deuterioacetate.
| Compound Name | [(2R,3R,4S,5R)-6-[3-(bromomethyl)-4-(cyanomethyl)phenyl]-3,4,5-tris[(2-deuterioacetyl)oxy]-6-hydroxyoxan-2-yl]methyl 2-deuterioacetate |
|---|---|
| PubChem CID | 141451778 |
| Molecular Formula | C23H26BrNO10 |
| Molecular Weight | 560.39 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | [(2R,3R,4S,5R)-6-[3-(bromomethyl)-4-(cyanomethyl)phenyl]-3,4,5-tris[(2-deuterioacetyl)oxy]-6-hydroxyoxan-2-yl]methyl 2-deuterioacetate |
| SMILES | [2H]CC(=O)OC[C@H]1OC(O)(c2ccc(CC#N)c(CBr)c2)[C@H](OC(=O)C[2H])[C@@H](OC(=O)C[2H])[C@@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C23H26BrNO10/c1-12(26)31-11-19-20(32-13(2)27)21(33-14(3)28)22(34-15(4)29)23(30,35-19)18-6-5-16(7-8-25)17(9-18)10-24/h5-6,9,19-22,30H,7,10-11H2,1-4H3/t19-,20-,21+,22-,23?/m1/s1/i1D,2D,3D,4D |
| InChIKey | QRPNCGYLYPJIJA-PAFJIIQYSA-N |
| XLogP | 1.55 |
| TPSA | 158.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|