C21H22FNO10 — CID 67131557
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(4-cyano-3-fluorophenyl)-6-hydroxyoxan-2-yl]methyl acetate (PubChem CID 67131557) has the molecular formula C21H22FNO10 and a molecular weight of 467.40 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(4-cyano-3-fluorophenyl)-6-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(4-cyano-3-fluorophenyl)-6-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 67131557 |
| Molecular Formula | C21H22FNO10 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-(4-cyano-3-fluorophenyl)-6-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(O)(c2ccc(C#N)c(F)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H22FNO10/c1-10(24)29-9-17-18(30-11(2)25)19(31-12(3)26)20(32-13(4)27)21(28,33-17)15-6-5-14(8-23)16(22)7-15/h5-7,17-20,28H,9H2,1-4H3/t17-,18-,19+,20-,21?/m1/s1 |
| InChIKey | YFYCOOHYXPFLFB-AWGDKMGJSA-N |
| XLogP | 0.60 |
| TPSA | 158.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|