C32H37ClO11 — CID 67131388
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(4-cyclopentyloxyphenyl)methyl]phenyl]-6-hydroxyoxan-2-yl]methyl acetate (PubChem CID 67131388) has the molecular formula C32H37ClO11 and a molecular weight of 633.09 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(4-cyclopentyloxyphenyl)methyl]phenyl]-6-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(4-cyclopentyloxyphenyl)methyl]phenyl]-6-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 67131388 |
| Molecular Formula | C32H37ClO11 |
| Molecular Weight | 633.09 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(4-cyclopentyloxyphenyl)methyl]phenyl]-6-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@](O)(c2ccc(Cl)c(Cc3ccc(OC4CCCC4)cc3)c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H37ClO11/c1-18(34)39-17-28-29(40-19(2)35)30(41-20(3)36)31(42-21(4)37)32(38,44-28)24-11-14-27(33)23(16-24)15-22-9-12-26(13-10-22)43-25-7-5-6-8-25/h9-14,16,25,28-31,38H,5-8,15,17H2,1-4H3/t28-,29-,30+,31-,32+/m1/s1 |
| InChIKey | DMDTVXMECUVASA-VJLURNNQSA-N |
| XLogP | 4.15 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.09 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|