C31H35NO10 — CID 66965707
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-cyano-5-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-hydroxyoxan-2-yl]methyl acetate (PubChem CID 66965707) has the molecular formula C31H35NO10 and a molecular weight of 581.62 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-cyano-5-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-cyano-5-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 66965707 |
| Molecular Formula | C31H35NO10 |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-cyano-5-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CCc1ccc(Cc2cc([C@]3(O)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)cc(C#N)c2C)cc1 |
| InChI | InChI=1S/C31H35NO10/c1-7-22-8-10-23(11-9-22)12-24-13-26(14-25(15-32)17(24)2)31(37)30(41-21(6)36)29(40-20(5)35)28(39-19(4)34)27(42-31)16-38-18(3)33/h8-11,13-14,27-30,37H,7,12,16H2,1-6H3/t27-,28-,29+,30-,31+/m1/s1 |
| InChIKey | YVWQYWMASJHMJT-SAEUYMBFSA-N |
| XLogP | 2.92 |
| TPSA | 158.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|