C26H36O11 — CID 175112103
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-(4-ethoxyphenyl)butyl]-6-hydroxyoxan-2-yl]methyl acetate (PubChem CID 175112103) has the molecular formula C26H36O11 and a molecular weight of 524.56 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-(4-ethoxyphenyl)butyl]-6-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-(4-ethoxyphenyl)butyl]-6-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 175112103 |
| Molecular Formula | C26H36O11 |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-(4-ethoxyphenyl)butyl]-6-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CCOc1ccc(CCCC[C@@]2(O)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C26H36O11/c1-6-32-21-12-10-20(11-13-21)9-7-8-14-26(31)25(36-19(5)30)24(35-18(4)29)23(34-17(3)28)22(37-26)15-33-16(2)27/h10-13,22-25,31H,6-9,14-15H2,1-5H3/t22-,23-,24+,25-,26-/m1/s1 |
| InChIKey | GBNLAEXEJQKGNJ-WSGIOKLISA-N |
| XLogP | 2.24 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|