C32H37ClO11 — CID 126752177
[3,4,5-triacetyloxy-6-[3-chloro-4-[(4-ethoxyphenyl)methyl]phenyl]-6-prop-2-enoxyoxan-2-yl]methyl acetate (PubChem CID 126752177) has the molecular formula C32H37ClO11 and a molecular weight of 633.09 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[3-chloro-4-[(4-ethoxyphenyl)methyl]phenyl]-6-prop-2-enoxyoxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[3-chloro-4-[(4-ethoxyphenyl)methyl]phenyl]-6-prop-2-enoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 126752177 |
| Molecular Formula | C32H37ClO11 |
| Molecular Weight | 633.09 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[3-chloro-4-[(4-ethoxyphenyl)methyl]phenyl]-6-prop-2-enoxyoxan-2-yl]methyl acetate |
| SMILES | C=CCOC1(c2ccc(Cc3ccc(OCC)cc3)c(Cl)c2)OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C32H37ClO11/c1-7-15-40-32(25-12-11-24(27(33)17-25)16-23-9-13-26(14-10-23)38-8-2)31(43-22(6)37)30(42-21(5)36)29(41-20(4)35)28(44-32)18-39-19(3)34/h7,9-14,17,28-31H,1,8,15-16,18H2,2-6H3 |
| InChIKey | WHKGRMLZXBHEAY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.09 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|