C34H41ClO10 — CID 68741434
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-5-[(4-ethylphenyl)methyl]-2-(2-prop-2-enoxyethyl)phenyl]oxan-2-yl]methyl acetate (PubChem CID 68741434) has the molecular formula C34H41ClO10 and a molecular weight of 645.15 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-5-[(4-ethylphenyl)methyl]-2-(2-prop-2-enoxyethyl)phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-5-[(4-ethylphenyl)methyl]-2-(2-prop-2-enoxyethyl)phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 68741434 |
| Molecular Formula | C34H41ClO10 |
| Molecular Weight | 645.15 g/mol |
| Exact Mass | 644.24 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-5-[(4-ethylphenyl)methyl]-2-(2-prop-2-enoxyethyl)phenyl]oxan-2-yl]methyl acetate |
| SMILES | C=CCOCCc1cc(Cl)c(Cc2ccc(CC)cc2)cc1[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C34H41ClO10/c1-7-14-40-15-13-26-18-29(35)27(16-25-11-9-24(8-2)10-12-25)17-28(26)31-33(43-22(5)38)34(44-23(6)39)32(42-21(4)37)30(45-31)19-41-20(3)36/h7,9-12,17-18,30-34H,1,8,13-16,19H2,2-6H3/t30-,31+,32-,33+,34+/m1/s1 |
| InChIKey | POMFGKIGWZSNJL-BBZHULIZSA-N |
| XLogP | 5.04 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.15 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|