C33H41ClO11 — CID 59557723
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-5-[(4-ethylphenyl)methyl]-2-[2-(2-hydroxyethoxy)ethyl]phenyl]oxan-2-yl]methyl acetate (PubChem CID 59557723) has the molecular formula C33H41ClO11 and a molecular weight of 649.13 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-5-[(4-ethylphenyl)methyl]-2-[2-(2-hydroxyethoxy)ethyl]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-5-[(4-ethylphenyl)methyl]-2-[2-(2-hydroxyethoxy)ethyl]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 59557723 |
| Molecular Formula | C33H41ClO11 |
| Molecular Weight | 649.13 g/mol |
| Exact Mass | 648.23 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-5-[(4-ethylphenyl)methyl]-2-[2-(2-hydroxyethoxy)ethyl]phenyl]oxan-2-yl]methyl acetate |
| SMILES | CCc1ccc(Cc2cc([C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)c(CCOCCO)cc2Cl)cc1 |
| InChI | InChI=1S/C33H41ClO11/c1-6-23-7-9-24(10-8-23)15-26-16-27(25(17-28(26)34)11-13-40-14-12-35)30-32(43-21(4)38)33(44-22(5)39)31(42-20(3)37)29(45-30)18-41-19(2)36/h7-10,16-17,29-33,35H,6,11-15,18H2,1-5H3/t29-,30+,31-,32+,33+/m1/s1 |
| InChIKey | MICANUCVNARWJC-LNALEXQMSA-N |
| XLogP | 3.84 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.13 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|