C38H51ClO11 — CID 166890654
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]phenyl]methyl]phenyl]oxan-2-yl]methyl acetate (PubChem CID 166890654) has the molecular formula C38H51ClO11 and a molecular weight of 719.27 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]phenyl]methyl]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]phenyl]methyl]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 166890654 |
| Molecular Formula | C38H51ClO11 |
| Molecular Weight | 719.27 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[[4-[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl]phenyl]methyl]phenyl]oxan-2-yl]methyl acetate |
| SMILES | COC(C)(C)CCOC(C)(C)CCc1ccc(Cc2cc([C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)ccc2Cl)cc1 |
| InChI | InChI=1S/C38H51ClO11/c1-23(40)45-22-32-34(47-24(2)41)36(49-26(4)43)35(48-25(3)42)33(50-32)29-14-15-31(39)30(21-29)20-28-12-10-27(11-13-28)16-17-38(7,8)46-19-18-37(5,6)44-9/h10-15,21,32-36H,16-20,22H2,1-9H3/t32-,33+,34-,35+,36+/m1/s1 |
| InChIKey | WKKLYHPJQSDHRQ-FMRHBUHZSA-N |
| XLogP | 6.27 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.27 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|