C28H31ClO11 — CID 71117768
[3,4,5-triacetyloxy-6-[4-chloro-3-(phenoxymethyl)phenyl]-6-methoxyoxan-2-yl]methyl acetate (PubChem CID 71117768) has the molecular formula C28H31ClO11 and a molecular weight of 579.00 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[4-chloro-3-(phenoxymethyl)phenyl]-6-methoxyoxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[4-chloro-3-(phenoxymethyl)phenyl]-6-methoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71117768 |
| Molecular Formula | C28H31ClO11 |
| Molecular Weight | 579.00 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[4-chloro-3-(phenoxymethyl)phenyl]-6-methoxyoxan-2-yl]methyl acetate |
| SMILES | COC1(c2ccc(Cl)c(COc3ccccc3)c2)OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C28H31ClO11/c1-16(30)35-15-24-25(37-17(2)31)26(38-18(3)32)27(39-19(4)33)28(34-5,40-24)21-11-12-23(29)20(13-21)14-36-22-9-7-6-8-10-22/h6-13,24-27H,14-15H2,1-5H3 |
| InChIKey | NDZBCEAMSWUECE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.00 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|