C23H28O12 — CID 541263
[3,4,5-triacetyloxy-5-(1-acetyloxy-2-phenoxyethyl)oxolan-2-yl]methyl acetate (PubChem CID 541263) has the molecular formula C23H28O12 and a molecular weight of 496.47 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-5-(1-acetyloxy-2-phenoxyethyl)oxolan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-5-(1-acetyloxy-2-phenoxyethyl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 541263 |
| Molecular Formula | C23H28O12 |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | [3,4,5-triacetyloxy-5-(1-acetyloxy-2-phenoxyethyl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OC(C)=O)(C(COc2ccccc2)OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C23H28O12/c1-13(24)29-11-19-21(32-15(3)26)22(33-16(4)27)23(35-19,34-17(5)28)20(31-14(2)25)12-30-18-9-7-6-8-10-18/h6-10,19-22H,11-12H2,1-5H3 |
| InChIKey | RQPLHZKOEGJJRX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|