C23H28O11 — CID 10719502
[(2R,3S,4R,5S,6R)-3,4,6-triacetyloxy-5-[(R)-acetyloxy(phenyl)methyl]oxan-2-yl]methyl acetate (PubChem CID 10719502) has the molecular formula C23H28O11 and a molecular weight of 480.47 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6R)-3,4,6-triacetyloxy-5-[(R)-acetyloxy(phenyl)methyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6R)-3,4,6-triacetyloxy-5-[(R)-acetyloxy(phenyl)methyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10719502 |
| Molecular Formula | C23H28O11 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | [(2R,3S,4R,5S,6R)-3,4,6-triacetyloxy-5-[(R)-acetyloxy(phenyl)methyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC(C)=O)[C@@H]([C@@H](OC(C)=O)c2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H28O11/c1-12(24)29-11-18-21(31-14(3)26)22(32-15(4)27)19(23(34-18)33-16(5)28)20(30-13(2)25)17-9-7-6-8-10-17/h6-10,18-23H,11H2,1-5H3/t18-,19+,20+,21-,22-,23+/m1/s1 |
| InChIKey | PHFSRIMPMUNBDA-XNZMWDKWSA-N |
| XLogP | 1.62 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|