C23H29NO11 — CID 163199401
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-amino-3-oxo-1-phenylpropoxy)oxan-2-yl]methyl acetate (PubChem CID 163199401) has the molecular formula C23H29NO11 and a molecular weight of 495.48 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-amino-3-oxo-1-phenylpropoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-amino-3-oxo-1-phenylpropoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163199401 |
| Molecular Formula | C23H29NO11 |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-amino-3-oxo-1-phenylpropoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(CC(N)=O)c2ccccc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H29NO11/c1-12(25)30-11-18-20(31-13(2)26)21(32-14(3)27)22(33-15(4)28)23(35-18)34-17(10-19(24)29)16-8-6-5-7-9-16/h5-9,17-18,20-23H,10-11H2,1-4H3,(H2,24,29)/t17?,18-,20-,21+,22-,23-/m1/s1 |
| InChIKey | TZITZLPGXMXDDD-CHIZFSKKSA-N |
| XLogP | 0.70 |
| TPSA | 166.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|