C17H20N2O9 — CID 170693392
[(2R,3R,4R,5S)-3,4-diacetyloxy-5-hydroxy-5-(pyridine-3-carbonylamino)oxolan-2-yl]methyl acetate (PubChem CID 170693392) has the molecular formula C17H20N2O9 and a molecular weight of 396.35 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4-diacetyloxy-5-hydroxy-5-(pyridine-3-carbonylamino)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S)-3,4-diacetyloxy-5-hydroxy-5-(pyridine-3-carbonylamino)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 170693392 |
| Molecular Formula | C17H20N2O9 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4-diacetyloxy-5-hydroxy-5-(pyridine-3-carbonylamino)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@](O)(NC(=O)c2cccnc2)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H20N2O9/c1-9(20)25-8-13-14(26-10(2)21)15(27-11(3)22)17(24,28-13)19-16(23)12-5-4-6-18-7-12/h4-7,13-15,24H,8H2,1-3H3,(H,19,23)/t13-,14-,15-,17+/m1/s1 |
| InChIKey | WJNOIUUZQXSYMM-ANQUJSFKSA-N |
| XLogP | -0.72 |
| TPSA | 150.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|