C18H21F3N2O11S — CID 175227414
[(2R,3R,4R)-4,5-diacetyloxy-3-(trifluoromethylsulfonyloxy)oxolan-2-yl]methyl acetate;pyridine-3-carboxamide (PubChem CID 175227414) has the molecular formula C18H21F3N2O11S and a molecular weight of 530.43 g/mol. Its IUPAC name is [(2R,3R,4R)-4,5-diacetyloxy-3-(trifluoromethylsulfonyloxy)oxolan-2-yl]methyl acetate;pyridine-3-carboxamide.
| Compound Name | [(2R,3R,4R)-4,5-diacetyloxy-3-(trifluoromethylsulfonyloxy)oxolan-2-yl]methyl acetate;pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175227414 |
| Molecular Formula | C18H21F3N2O11S |
| Molecular Weight | 530.43 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | [(2R,3R,4R)-4,5-diacetyloxy-3-(trifluoromethylsulfonyloxy)oxolan-2-yl]methyl acetate;pyridine-3-carboxamide |
| SMILES | CC(=O)OC[C@H]1OC(OC(C)=O)[C@H](OC(C)=O)[C@@H]1OS(=O)(=O)C(F)(F)F.NC(=O)c1cccnc1 |
| InChI | InChI=1S/C12H15F3O10S.C6H6N2O/c1-5(16)21-4-8-9(25-26(19,20)12(13,14)15)10(22-6(2)17)11(24-8)23-7(3)18;7-6(9)5-2-1-3-8-4-5/h8-11H,4H2,1-3H3;1-4H,(H2,7,9)/t8-,9-,10-,11?;/m1./s1 |
| InChIKey | IRLKMNWGXTZKBP-VXYQODEOSA-N |
| XLogP | 0.18 |
| TPSA | 187.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.43 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|