C13H16F6O12S2 — CID 16663872
[(2R,3S,4S,5R,6R)-4-acetyloxy-6-methoxy-3,5-bis(trifluoromethylsulfonyloxy)oxan-2-yl]methyl acetate (PubChem CID 16663872) has the molecular formula C13H16F6O12S2 and a molecular weight of 542.38 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-4-acetyloxy-6-methoxy-3,5-bis(trifluoromethylsulfonyloxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-4-acetyloxy-6-methoxy-3,5-bis(trifluoromethylsulfonyloxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 16663872 |
| Molecular Formula | C13H16F6O12S2 |
| Molecular Weight | 542.38 g/mol |
| Exact Mass | 542.00 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-4-acetyloxy-6-methoxy-3,5-bis(trifluoromethylsulfonyloxy)oxan-2-yl]methyl acetate |
| SMILES | CO[C@@H]1O[C@H](COC(C)=O)[C@H](OS(=O)(=O)C(F)(F)F)[C@H](OC(C)=O)[C@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H16F6O12S2/c1-5(20)27-4-7-8(30-32(22,23)12(14,15)16)9(28-6(2)21)10(11(26-3)29-7)31-33(24,25)13(17,18)19/h7-11H,4H2,1-3H3/t7-,8+,9+,10-,11-/m1/s1 |
| InChIKey | BFAABZMNAUAWEE-ZKKRXERASA-N |
| XLogP | 0.32 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.38 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|