C16H19F3O11S — CID 101465001
[(2R,3R,4S,5S,6R)-3,4-diacetyloxy-6-prop-2-ynoxy-5-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl acetate (PubChem CID 101465001) has the molecular formula C16H19F3O11S and a molecular weight of 476.38 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4-diacetyloxy-6-prop-2-ynoxy-5-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4-diacetyloxy-6-prop-2-ynoxy-5-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101465001 |
| Molecular Formula | C16H19F3O11S |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4-diacetyloxy-6-prop-2-ynoxy-5-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl acetate |
| SMILES | C#CCO[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H19F3O11S/c1-5-6-25-15-14(30-31(23,24)16(17,18)19)13(28-10(4)22)12(27-9(3)21)11(29-15)7-26-8(2)20/h1,11-15H,6-7H2,2-4H3/t11-,12-,13+,14+,15-/m1/s1 |
| InChIKey | GBCCDWOENWHWLH-NIFZNCRKSA-N |
| XLogP | 0.02 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|