C19H26O10 — CID 72821497
(3,4,5-triacetyloxy-6-pent-4-ynoxyoxan-2-yl)methyl acetate (PubChem CID 72821497) has the molecular formula C19H26O10 and a molecular weight of 414.41 g/mol. Its IUPAC name is (3,4,5-triacetyloxy-6-pent-4-ynoxyoxan-2-yl)methyl acetate.
| Compound Name | (3,4,5-triacetyloxy-6-pent-4-ynoxyoxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 72821497 |
| Molecular Formula | C19H26O10 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | (3,4,5-triacetyloxy-6-pent-4-ynoxyoxan-2-yl)methyl acetate |
| SMILES | C#CCCCOC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C19H26O10/c1-6-7-8-9-24-19-18(28-14(5)23)17(27-13(4)22)16(26-12(3)21)15(29-19)10-25-11(2)20/h1,15-19H,7-10H2,2-5H3 |
| InChIKey | DCNRGSSHJCSNQE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|