C16H20F6O15S2 — CID 162197672
[(2R,3R,4S,5S,6S)-3,4,6-triacetyloxy-5-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl acetate;trifluoromethanesulfonic acid (PubChem CID 162197672) has the molecular formula C16H20F6O15S2 and a molecular weight of 630.44 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3,4,6-triacetyloxy-5-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl acetate;trifluoromethanesulfonic acid.
| Compound Name | [(2R,3R,4S,5S,6S)-3,4,6-triacetyloxy-5-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl acetate;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 162197672 |
| Molecular Formula | C16H20F6O15S2 |
| Molecular Weight | 630.44 g/mol |
| Exact Mass | 630.01 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3,4,6-triacetyloxy-5-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl acetate;trifluoromethanesulfonic acid |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@@H](OS(=O)(=O)C(F)(F)F)[C@@H](OC(C)=O)[C@@H]1OC(C)=O.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C15H19F3O12S.CHF3O3S/c1-6(19)25-5-10-11(26-7(2)20)12(27-8(3)21)13(14(29-10)28-9(4)22)30-31(23,24)15(16,17)18;2-1(3,4)8(5,6)7/h10-14H,5H2,1-4H3;(H,5,6,7)/t10-,11-,12+,13+,14-;/m1./s1 |
| InChIKey | ZRDXSGSEIASFQY-RDTZALLJSA-N |
| XLogP | 0.33 |
| TPSA | 212.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.44 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|