C30H21F3N4O10 — CID 70876195
[(2R,3R,4S,5R)-3,4-bis[(2-fluoropyridine-3-carbonyl)oxy]-5-hydroxy-5-(pyridine-3-carbonyloxymethyl)oxolan-2-yl]methyl 2-fluoropyridine-3-carboxylate (PubChem CID 70876195) has the molecular formula C30H21F3N4O10 and a molecular weight of 654.51 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4-bis[(2-fluoropyridine-3-carbonyl)oxy]-5-hydroxy-5-(pyridine-3-carbonyloxymethyl)oxolan-2-yl]methyl 2-fluoropyridine-3-carboxylate.
| Compound Name | [(2R,3R,4S,5R)-3,4-bis[(2-fluoropyridine-3-carbonyl)oxy]-5-hydroxy-5-(pyridine-3-carbonyloxymethyl)oxolan-2-yl]methyl 2-fluoropyridine-3-carboxylate |
|---|---|
| PubChem CID | 70876195 |
| Molecular Formula | C30H21F3N4O10 |
| Molecular Weight | 654.51 g/mol |
| Exact Mass | 654.12 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4-bis[(2-fluoropyridine-3-carbonyl)oxy]-5-hydroxy-5-(pyridine-3-carbonyloxymethyl)oxolan-2-yl]methyl 2-fluoropyridine-3-carboxylate |
| SMILES | O=C(OC[C@@]1(O)O[C@H](COC(=O)c2cccnc2F)[C@@H](OC(=O)c2cccnc2F)[C@@H]1OC(=O)c1cccnc1F)c1cccnc1 |
| InChI | InChI=1S/C30H21F3N4O10/c31-23-17(6-2-10-35-23)27(39)43-14-20-21(45-28(40)18-7-3-11-36-24(18)32)22(46-29(41)19-8-4-12-37-25(19)33)30(42,47-20)15-44-26(38)16-5-1-9-34-13-16/h1-13,20-22,42H,14-15H2/t20-,21-,22+,30-/m1/s1 |
| InChIKey | VLVZQDKQRIKVMO-XOKRHZQPSA-N |
| XLogP | 2.24 |
| TPSA | 186.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|