C20H20N2O7 — CID 142289111
[(3aR,6R,6aR)-2,2-dimethyl-4-(pyridine-3-carbonyloxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl pyridine-3-carboxylate (PubChem CID 142289111) has the molecular formula C20H20N2O7 and a molecular weight of 400.39 g/mol. Its IUPAC name is [(3aR,6R,6aR)-2,2-dimethyl-4-(pyridine-3-carbonyloxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl pyridine-3-carboxylate.
| Compound Name | [(3aR,6R,6aR)-2,2-dimethyl-4-(pyridine-3-carbonyloxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 142289111 |
| Molecular Formula | C20H20N2O7 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | [(3aR,6R,6aR)-2,2-dimethyl-4-(pyridine-3-carbonyloxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl pyridine-3-carboxylate |
| SMILES | CC1(C)O[C@@H]2[C@@H](COC(=O)c3cccnc3)OC(OC(=O)c3cccnc3)[C@@H]2O1 |
| InChI | InChI=1S/C20H20N2O7/c1-20(2)28-15-14(11-25-17(23)12-5-3-7-21-9-12)26-19(16(15)29-20)27-18(24)13-6-4-8-22-10-13/h3-10,14-16,19H,11H2,1-2H3/t14-,15-,16-,19?/m1/s1 |
| InChIKey | JCUBCHABVQUUOT-OJEBHDCCSA-N |
| XLogP | 1.74 |
| TPSA | 106.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |