C11H13NO5 — CID 170219804
[(3S,4S)-3,4-dihydroxyoxolan-2-yl]methyl pyridine-3-carboxylate (PubChem CID 170219804) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is [(3S,4S)-3,4-dihydroxyoxolan-2-yl]methyl pyridine-3-carboxylate.
| Compound Name | [(3S,4S)-3,4-dihydroxyoxolan-2-yl]methyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 170219804 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | [(3S,4S)-3,4-dihydroxyoxolan-2-yl]methyl pyridine-3-carboxylate |
| SMILES | O=C(OCC1OC[C@H](O)[C@@H]1O)c1cccnc1 |
| InChI | InChI=1S/C11H13NO5/c13-8-5-16-9(10(8)14)6-17-11(15)7-2-1-3-12-4-7/h1-4,8-10,13-14H,5-6H2/t8-,9?,10-/m0/s1 |
| InChIKey | PUMCROKQSBUGIJ-SMILAEQMSA-N |
| XLogP | -0.64 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |