C14H18N2O7 — CID 152756049
[(2R,3S,4R,5R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl pyridine-3-carboxylate (PubChem CID 152756049) has the molecular formula C14H18N2O7 and a molecular weight of 326.31 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl pyridine-3-carboxylate.
| Compound Name | [(2R,3S,4R,5R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 152756049 |
| Molecular Formula | C14H18N2O7 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | [(2R,3S,4R,5R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl pyridine-3-carboxylate |
| SMILES | CC(=O)N[C@H]1C(O)O[C@H](COC(=O)c2cccnc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H18N2O7/c1-7(17)16-10-12(19)11(18)9(23-14(10)21)6-22-13(20)8-3-2-4-15-5-8/h2-5,9-12,14,18-19,21H,6H2,1H3,(H,16,17)/t9-,10-,11-,12-,14?/m1/s1 |
| InChIKey | PBNJUUUZXIGYOR-WJVRHOARSA-N |
| XLogP | -1.82 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |