C11H13NO4 — CID 169177178
(5-hydroxyoxolan-2-yl)methyl pyridine-3-carboxylate (PubChem CID 169177178) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is (5-hydroxyoxolan-2-yl)methyl pyridine-3-carboxylate.
| Compound Name | (5-hydroxyoxolan-2-yl)methyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 169177178 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (5-hydroxyoxolan-2-yl)methyl pyridine-3-carboxylate |
| SMILES | O=C(OCC1CCC(O)O1)c1cccnc1 |
| InChI | InChI=1S/C11H13NO4/c13-10-4-3-9(16-10)7-15-11(14)8-2-1-5-12-6-8/h1-2,5-6,9-10,13H,3-4,7H2 |
| InChIKey | SSHDCBPBFJPTQR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |