C15H23NO4 — CID 142544191
(5-hydroxyoxolan-2-yl)methyl 4-methylbenzoate;N-methylmethanamine (PubChem CID 142544191) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is (5-hydroxyoxolan-2-yl)methyl 4-methylbenzoate;N-methylmethanamine.
| Compound Name | (5-hydroxyoxolan-2-yl)methyl 4-methylbenzoate;N-methylmethanamine |
|---|---|
| PubChem CID | 142544191 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (5-hydroxyoxolan-2-yl)methyl 4-methylbenzoate;N-methylmethanamine |
| SMILES | CNC.Cc1ccc(C(=O)OCC2CCC(O)O2)cc1 |
| InChI | InChI=1S/C13H16O4.C2H7N/c1-9-2-4-10(5-3-9)13(15)16-8-11-6-7-12(14)17-11;1-3-2/h2-5,11-12,14H,6-8H2,1H3;3H,1-2H3 |
| InChIKey | GEMAOFUDCIAPAD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |