C14H17NO5 — CID 137453027
[(2S)-5-(acetyloxyamino)oxolan-2-yl]methyl benzoate (PubChem CID 137453027) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is [(2S)-5-(acetyloxyamino)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2S)-5-(acetyloxyamino)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 137453027 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | [(2S)-5-(acetyloxyamino)oxolan-2-yl]methyl benzoate |
| SMILES | CC(=O)ONC1CC[C@@H](COC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C14H17NO5/c1-10(16)20-15-13-8-7-12(19-13)9-18-14(17)11-5-3-2-4-6-11/h2-6,12-13,15H,7-9H2,1H3/t12-,13?/m0/s1 |
| InChIKey | SXRVMBDWJLGUQH-UEWDXFNNSA-N |
| XLogP | 1.42 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|