C15H18ClNO3 — CID 156804245
[5-[[(Z)-prop-1-enyl]amino]oxolan-2-yl]methyl 3-chlorobenzoate (PubChem CID 156804245) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is [5-[[(Z)-prop-1-enyl]amino]oxolan-2-yl]methyl 3-chlorobenzoate.
| Compound Name | [5-[[(Z)-prop-1-enyl]amino]oxolan-2-yl]methyl 3-chlorobenzoate |
|---|---|
| PubChem CID | 156804245 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | [5-[[(Z)-prop-1-enyl]amino]oxolan-2-yl]methyl 3-chlorobenzoate |
| SMILES | C/C=C\NC1CCC(COC(=O)c2cccc(Cl)c2)O1 |
| InChI | InChI=1S/C15H18ClNO3/c1-2-8-17-14-7-6-13(20-14)10-19-15(18)11-4-3-5-12(16)9-11/h2-5,8-9,13-14,17H,6-7,10H2,1H3/b8-2- |
| InChIKey | CPFGKNAWNAXHBV-WAPJZHGLSA-N |
| XLogP | 3.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |