C17H19ClN2O5 — CID 171528800
[5-[formyl-[(Z)-3-(methylamino)-3-oxoprop-1-enyl]amino]oxolan-2-yl]methyl 3-chlorobenzoate (PubChem CID 171528800) has the molecular formula C17H19ClN2O5 and a molecular weight of 366.80 g/mol. Its IUPAC name is [5-[formyl-[(Z)-3-(methylamino)-3-oxoprop-1-enyl]amino]oxolan-2-yl]methyl 3-chlorobenzoate.
| Compound Name | [5-[formyl-[(Z)-3-(methylamino)-3-oxoprop-1-enyl]amino]oxolan-2-yl]methyl 3-chlorobenzoate |
|---|---|
| PubChem CID | 171528800 |
| Molecular Formula | C17H19ClN2O5 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [5-[formyl-[(Z)-3-(methylamino)-3-oxoprop-1-enyl]amino]oxolan-2-yl]methyl 3-chlorobenzoate |
| SMILES | CNC(=O)/C=C\N(C=O)C1CCC(COC(=O)c2cccc(Cl)c2)O1 |
| InChI | InChI=1S/C17H19ClN2O5/c1-19-15(22)7-8-20(11-21)16-6-5-14(25-16)10-24-17(23)12-3-2-4-13(18)9-12/h2-4,7-9,11,14,16H,5-6,10H2,1H3,(H,19,22)/b8-7- |
| InChIKey | DTRBJQYJALNLIV-FPLPWBNLSA-N |
| XLogP | 1.72 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|